About N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide
N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide (PubChem CID 8895031) has the molecular formula C21H18ClN3O3
and a molecular weight of 395.85 g/mol. Its IUPAC name is N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide |
| PubChem CID | 8895031 |
| Molecular Formula | C21H18ClN3O3 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide |
| SMILES | CCCN(Cc1nnc(-c2ccccc2Cl)o1)C(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H18ClN3O3/c1-2-11-25(21(26)18-12-14-7-3-6-10-17(14)27-18)13-19-23-24-20(28-19)15-8-4-5-9-16(15)22/h3-10,12H,2,11,13H2,1H3 |
| InChIKey | WEOUHWIJXVMZFO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 72.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide?
The IUPAC name of N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide (CID 8895031) is N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide.
What is the SMILES notation for N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide?
The canonical SMILES for N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide is CCCN(Cc1nnc(-c2ccccc2Cl)o1)C(=O)c1cc2ccccc2o1.
What is the InChIKey of N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide?
The InChIKey is WEOUHWIJXVMZFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClN3O3/c1-2-11-25(21(26)18-12-14-7-3-6-10-17(14)27-18)13-19-23-24-20(28-19)15-8-4-5-9-16(15)22/h3-10,12H,2,11,13H2,1H3.
What are the key properties of N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide?
N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide has a molecular weight of 395.85 g/mol, XLogP of 5.19, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-propyl-1-benzofuran-2-carboxamide is sourced from PubChem (CID 8895031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).