C15H24O3 — CID 88950357
(2E,6E)-10-hydroxy-5,9-dimethyltrideca-2,6-diene-4,8-dione (PubChem CID 88950357) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (2E,6E)-10-hydroxy-5,9-dimethyltrideca-2,6-diene-4,8-dione.
| Compound Name | (2E,6E)-10-hydroxy-5,9-dimethyltrideca-2,6-diene-4,8-dione |
|---|---|
| PubChem CID | 88950357 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (2E,6E)-10-hydroxy-5,9-dimethyltrideca-2,6-diene-4,8-dione |
| SMILES | C/C=C/C(=O)C(C)/C=C/C(=O)C(C)C(O)CCC |
| InChI | InChI=1S/C15H24O3/c1-5-7-13(16)11(3)9-10-15(18)12(4)14(17)8-6-2/h5,7,9-12,14,17H,6,8H2,1-4H3/b7-5+,10-9+ |
| InChIKey | DNCSHMSBLFXNQK-GLVZAGOZSA-N |
| XLogP | 2.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|