C18H24N3O5P — CID 88950371
ethyl-[[6-[[[3-(hydroxymethyl)phenyl]methylcarbamoylamino]methyl]-2-pyridinyl]methoxy]phosphinic acid (PubChem CID 88950371) has the molecular formula C18H24N3O5P and a molecular weight of 393.38 g/mol. Its IUPAC name is ethyl-[[6-[[[3-(hydroxymethyl)phenyl]methylcarbamoylamino]methyl]-2-pyridinyl]methoxy]phosphinic acid.
| Compound Name | ethyl-[[6-[[[3-(hydroxymethyl)phenyl]methylcarbamoylamino]methyl]-2-pyridinyl]methoxy]phosphinic acid |
|---|---|
| PubChem CID | 88950371 |
| Molecular Formula | C18H24N3O5P |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | ethyl-[[6-[[[3-(hydroxymethyl)phenyl]methylcarbamoylamino]methyl]-2-pyridinyl]methoxy]phosphinic acid |
| SMILES | CCP(=O)(O)OCc1cccc(CNC(=O)NCc2cccc(CO)c2)n1 |
| InChI | InChI=1S/C18H24N3O5P/c1-2-27(24,25)26-13-17-8-4-7-16(21-17)11-20-18(23)19-10-14-5-3-6-15(9-14)12-22/h3-9,22H,2,10-13H2,1H3,(H,24,25)(H2,19,20,23) |
| InChIKey | RQAHUXNIUDLYPT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|