About CID 88950501
CID 88950501 (PubChem CID 88950501) has the molecular formula C24H16BFN2O
and a molecular weight of 378.22 g/mol.
Molecular Properties
| Compound Name | CID 88950501 |
| PubChem CID | 88950501 |
| Molecular Formula | C24H16BFN2O |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2ccn(-c3ccc(O)c(F)c3)c2-c2ccc(C#N)cc2C)cc1 |
| InChI | InChI=1S/C24H16BFN2O/c1-15-12-16(14-27)2-8-20(15)24-21(17-3-5-18(25)6-4-17)10-11-28(24)19-7-9-23(29)22(26)13-19/h2-13,29H,1H3 |
| InChIKey | DAZBWJWQGJXODJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88950501 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88950501?
The IUPAC name of CID 88950501 (CID 88950501) is not available.
What is the SMILES notation for CID 88950501?
The canonical SMILES for CID 88950501 is [B]c1ccc(-c2ccn(-c3ccc(O)c(F)c3)c2-c2ccc(C#N)cc2C)cc1.
What is the InChIKey of CID 88950501?
The InChIKey is DAZBWJWQGJXODJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16BFN2O/c1-15-12-16(14-27)2-8-20(15)24-21(17-3-5-18(25)6-4-17)10-11-28(24)19-7-9-23(29)22(26)13-19/h2-13,29H,1H3.
What are the key properties of CID 88950501?
CID 88950501 has a molecular weight of 378.22 g/mol, XLogP of 4.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88950501 is sourced from PubChem (CID 88950501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).