C17H17ClFNO2 — CID 88950593
ethyl (1R,2R,3R)-2-(6-chloro-3-pyridinyl)-3-(2-fluorocyclohexa-2,4-dien-1-yl)cyclopropane-1-carboxylate (PubChem CID 88950593) has the molecular formula C17H17ClFNO2 and a molecular weight of 321.78 g/mol. Its IUPAC name is ethyl (1R,2R,3R)-2-(6-chloro-3-pyridinyl)-3-(2-fluorocyclohexa-2,4-dien-1-yl)cyclopropane-1-carboxylate.
| Compound Name | ethyl (1R,2R,3R)-2-(6-chloro-3-pyridinyl)-3-(2-fluorocyclohexa-2,4-dien-1-yl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88950593 |
| Molecular Formula | C17H17ClFNO2 |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | ethyl (1R,2R,3R)-2-(6-chloro-3-pyridinyl)-3-(2-fluorocyclohexa-2,4-dien-1-yl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](c2ccc(Cl)nc2)[C@H]1C1CC=CC=C1F |
| InChI | InChI=1S/C17H17ClFNO2/c1-2-22-17(21)16-14(10-7-8-13(18)20-9-10)15(16)11-5-3-4-6-12(11)19/h3-4,6-9,11,14-16H,2,5H2,1H3/t11?,14-,15-,16+/m1/s1 |
| InChIKey | KLRNEVBYRKSZDK-ABPYZFRZSA-N |
| XLogP | 4.06 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|