C11H13F3N2O — CID 88951038
4-[(2E,4E,6Z)-1,1,1-trifluoroocta-2,4,6-trien-4-yl]imidazolidin-2-one (PubChem CID 88951038) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is 4-[(2E,4E,6Z)-1,1,1-trifluoroocta-2,4,6-trien-4-yl]imidazolidin-2-one.
| Compound Name | 4-[(2E,4E,6Z)-1,1,1-trifluoroocta-2,4,6-trien-4-yl]imidazolidin-2-one |
|---|---|
| PubChem CID | 88951038 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 4-[(2E,4E,6Z)-1,1,1-trifluoroocta-2,4,6-trien-4-yl]imidazolidin-2-one |
| SMILES | C/C=C\C=C(/C=C/C(F)(F)F)C1CNC(=O)N1 |
| InChI | InChI=1S/C11H13F3N2O/c1-2-3-4-8(5-6-11(12,13)14)9-7-15-10(17)16-9/h2-6,9H,7H2,1H3,(H2,15,16,17)/b3-2-,6-5+,8-4+ |
| InChIKey | XSWVJKVKBAVIHU-SRECFSNQSA-N |
| XLogP | 2.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|