C25H21F3IN3O2 — CID 88951120
6-(2,6-difluoro-4-formylphenyl)-5-fluoro-N-[4-[(5S)-3-iodo-5-methylcyclohexyl]-3-pyridinyl]pyridine-2-carboxamide (PubChem CID 88951120) has the molecular formula C25H21F3IN3O2 and a molecular weight of 579.36 g/mol. Its IUPAC name is 6-(2,6-difluoro-4-formylphenyl)-5-fluoro-N-[4-[(5S)-3-iodo-5-methylcyclohexyl]-3-pyridinyl]pyridine-2-carboxamide.
| Compound Name | 6-(2,6-difluoro-4-formylphenyl)-5-fluoro-N-[4-[(5S)-3-iodo-5-methylcyclohexyl]-3-pyridinyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 88951120 |
| Molecular Formula | C25H21F3IN3O2 |
| Molecular Weight | 579.36 g/mol |
| Exact Mass | 579.06 |
| IUPAC Name | 6-(2,6-difluoro-4-formylphenyl)-5-fluoro-N-[4-[(5S)-3-iodo-5-methylcyclohexyl]-3-pyridinyl]pyridine-2-carboxamide |
| SMILES | C[C@@H]1CC(I)CC(c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(C=O)cc3F)n2)C1 |
| InChI | InChI=1S/C25H21F3IN3O2/c1-13-6-15(10-16(29)7-13)17-4-5-30-11-22(17)32-25(34)21-3-2-18(26)24(31-21)23-19(27)8-14(12-33)9-20(23)28/h2-5,8-9,11-13,15-16H,6-7,10H2,1H3,(H,32,34)/t13-,15?,16?/m0/s1 |
| InChIKey | UWYLJWGGKXHHTQ-JEYLPNPQSA-N |
| XLogP | 6.33 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.36 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|