About [dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate
[dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate (PubChem CID 88951144) has the molecular formula C7H14N2S4
and a molecular weight of 254.47 g/mol. Its IUPAC name is [dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | [dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate |
| PubChem CID | 88951144 |
| Molecular Formula | C7H14N2S4 |
| Molecular Weight | 254.47 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | [dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate |
| SMILES | C=S=C(SSC(=S)N(C)C)N(C)C |
| InChI | InChI=1S/C7H14N2S4/c1-8(2)6(10)12-13-7(11-5)9(3)4/h5H2,1-4H3 |
| InChIKey | BLHLBNSUHAMZLB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate?
The IUPAC name of [dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate (CID 88951144) is [dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate.
What is the SMILES notation for [dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate?
The canonical SMILES for [dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate is C=S=C(SSC(=S)N(C)C)N(C)C.
What is the InChIKey of [dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate?
The InChIKey is BLHLBNSUHAMZLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S4/c1-8(2)6(10)12-13-7(11-5)9(3)4/h5H2,1-4H3.
What are the key properties of [dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate?
[dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate has a molecular weight of 254.47 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethylamino-(methylidene-λ4-sulfanylidene)methyl]sulfanyl N,N-dimethylcarbamodithioate is sourced from PubChem (CID 88951144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).