C28H28N8OS — CID 88951221
N-[3-[1-(2-aminophenyl)sulfanylpiperidin-4-yl]-1-(4-methylphenyl)pyrazol-5-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 88951221) has the molecular formula C28H28N8OS and a molecular weight of 524.65 g/mol. Its IUPAC name is N-[3-[1-(2-aminophenyl)sulfanylpiperidin-4-yl]-1-(4-methylphenyl)pyrazol-5-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[3-[1-(2-aminophenyl)sulfanylpiperidin-4-yl]-1-(4-methylphenyl)pyrazol-5-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 88951221 |
| Molecular Formula | C28H28N8OS |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | N-[3-[1-(2-aminophenyl)sulfanylpiperidin-4-yl]-1-(4-methylphenyl)pyrazol-5-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1ccc(-n2nc(C3CCN(Sc4ccccc4N)CC3)cc2NC(=O)c2cnn3cccnc23)cc1 |
| InChI | InChI=1S/C28H28N8OS/c1-19-7-9-21(10-8-19)36-26(32-28(37)22-18-31-35-14-4-13-30-27(22)35)17-24(33-36)20-11-15-34(16-12-20)38-25-6-3-2-5-23(25)29/h2-10,13-14,17-18,20H,11-12,15-16,29H2,1H3,(H,32,37) |
| InChIKey | CSFBZZSXCSZOEK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 106.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|