C22H21F3O4S — CID 88951845
[(11S)-13-oxo-1-phenyl-5-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trienyl] trifluoromethanesulfonate (PubChem CID 88951845) has the molecular formula C22H21F3O4S and a molecular weight of 438.47 g/mol. Its IUPAC name is [(11S)-13-oxo-1-phenyl-5-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trienyl] trifluoromethanesulfonate.
| Compound Name | [(11S)-13-oxo-1-phenyl-5-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trienyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88951845 |
| Molecular Formula | C22H21F3O4S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | [(11S)-13-oxo-1-phenyl-5-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trienyl] trifluoromethanesulfonate |
| SMILES | O=C1CCC2(c3ccccc3)c3ccc(OS(=O)(=O)C(F)(F)F)cc3CCC[C@H]2C1 |
| InChI | InChI=1S/C22H21F3O4S/c23-22(24,25)30(27,28)29-19-9-10-20-15(13-19)5-4-8-17-14-18(26)11-12-21(17,20)16-6-2-1-3-7-16/h1-3,6-7,9-10,13,17H,4-5,8,11-12,14H2/t17-,21?/m0/s1 |
| InChIKey | QADSPFKYFRMDMA-PBVYKCSPSA-N |
| XLogP | 4.91 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|