C28H37FO6 — CID 88951997
(3Z,4Z,11Z)-4-ethylidene-3-[(2E,4E,5Z,7Z)-4-ethylidene-1-hydroxy-3-methylnona-2,5,7-trienylidene]-13-fluoro-8,9-dihydroxy-14-methyl-1-oxacyclotetradec-11-ene-2,10-dione (PubChem CID 88951997) has the molecular formula C28H37FO6 and a molecular weight of 488.60 g/mol. Its IUPAC name is (3Z,4Z,11Z)-4-ethylidene-3-[(2E,4E,5Z,7Z)-4-ethylidene-1-hydroxy-3-methylnona-2,5,7-trienylidene]-13-fluoro-8,9-dihydroxy-14-methyl-1-oxacyclotetradec-11-ene-2,10-dione.
| Compound Name | (3Z,4Z,11Z)-4-ethylidene-3-[(2E,4E,5Z,7Z)-4-ethylidene-1-hydroxy-3-methylnona-2,5,7-trienylidene]-13-fluoro-8,9-dihydroxy-14-methyl-1-oxacyclotetradec-11-ene-2,10-dione |
|---|---|
| PubChem CID | 88951997 |
| Molecular Formula | C28H37FO6 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | (3Z,4Z,11Z)-4-ethylidene-3-[(2E,4E,5Z,7Z)-4-ethylidene-1-hydroxy-3-methylnona-2,5,7-trienylidene]-13-fluoro-8,9-dihydroxy-14-methyl-1-oxacyclotetradec-11-ene-2,10-dione |
| SMILES | C/C=C\C=C/C(=C\C)/C(C)=C/C(O)=C1/C(=O)OC(C)C(F)/C=C\C(=O)C(O)C(O)CCC/C1=C/C |
| InChI | InChI=1S/C28H37FO6/c1-6-9-10-12-20(7-2)18(4)17-25(32)26-21(8-3)13-11-14-23(30)27(33)24(31)16-15-22(29)19(5)35-28(26)34/h6-10,12,15-17,19,22-23,27,30,32-33H,11,13-14H2,1-5H3/b9-6-,12-10-,16-15-,18-17+,20-7+,21-8-,26-25- |
| InChIKey | WKWYDAZUIHQVKZ-YKEWHKNTSA-N |
| XLogP | 5.07 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|