C32H41FN2O5 — CID 88952014
4-[[4-[(Z)-4-[2-ethyl-5-[(2-fluoroethylamino)methyl]phenyl]-1-hydroxybut-2-enyl]-2,5-dimethylidene-3-oxocyclohexyl]methyl]-5-(hydroxymethyl)-6-oxocyclohexene-1-carboxamide (PubChem CID 88952014) has the molecular formula C32H41FN2O5 and a molecular weight of 552.69 g/mol. Its IUPAC name is 4-[[4-[(Z)-4-[2-ethyl-5-[(2-fluoroethylamino)methyl]phenyl]-1-hydroxybut-2-enyl]-2,5-dimethylidene-3-oxocyclohexyl]methyl]-5-(hydroxymethyl)-6-oxocyclohexene-1-carboxamide.
| Compound Name | 4-[[4-[(Z)-4-[2-ethyl-5-[(2-fluoroethylamino)methyl]phenyl]-1-hydroxybut-2-enyl]-2,5-dimethylidene-3-oxocyclohexyl]methyl]-5-(hydroxymethyl)-6-oxocyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 88952014 |
| Molecular Formula | C32H41FN2O5 |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 4-[[4-[(Z)-4-[2-ethyl-5-[(2-fluoroethylamino)methyl]phenyl]-1-hydroxybut-2-enyl]-2,5-dimethylidene-3-oxocyclohexyl]methyl]-5-(hydroxymethyl)-6-oxocyclohexene-1-carboxamide |
| SMILES | C=C1C(=O)C(C(O)/C=C\Cc2cc(CNCCF)ccc2CC)C(=C)CC1CC1CC=C(C(N)=O)C(=O)C1CO |
| InChI | InChI=1S/C32H41FN2O5/c1-4-22-9-8-21(17-35-13-12-33)15-23(22)6-5-7-28(37)29-19(2)14-25(20(3)30(29)38)16-24-10-11-26(32(34)40)31(39)27(24)18-36/h5,7-9,11,15,24-25,27-29,35-37H,2-4,6,10,12-14,16-18H2,1H3,(H2,34,40)/b7-5- |
| InChIKey | ZYNAPVWLZKQLBX-ALCCZGGFSA-N |
| XLogP | 3.08 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|