C23H33N3 — CID 88952314
(2Z)-N-[(3R)-3-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylbut-1-en-2-yl]-2-hydrazinylidenecycloheptan-1-imine (PubChem CID 88952314) has the molecular formula C23H33N3 and a molecular weight of 351.54 g/mol. Its IUPAC name is (2Z)-N-[(3R)-3-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylbut-1-en-2-yl]-2-hydrazinylidenecycloheptan-1-imine.
| Compound Name | (2Z)-N-[(3R)-3-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylbut-1-en-2-yl]-2-hydrazinylidenecycloheptan-1-imine |
|---|---|
| PubChem CID | 88952314 |
| Molecular Formula | C23H33N3 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | (2Z)-N-[(3R)-3-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylbut-1-en-2-yl]-2-hydrazinylidenecycloheptan-1-imine |
| SMILES | C=C(/N=C1\CCCCC\C1=N\N)[C@@](C)(C1=CCCC=C1)C1C=CCCC1 |
| InChI | InChI=1S/C23H33N3/c1-18(25-21-16-10-5-11-17-22(21)26-24)23(2,19-12-6-3-7-13-19)20-14-8-4-9-15-20/h6,8,12-14,20H,1,3-5,7,9-11,15-17,24H2,2H3/b25-21+,26-22-/t20?,23-/m0/s1 |
| InChIKey | YMUDSMZTRNSGTI-SLFFKVRUSA-N |
| XLogP | 5.86 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|