About [4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate
[4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate (PubChem CID 88952564) has the molecular formula C24H22O4
and a molecular weight of 374.44 g/mol. Its IUPAC name is [4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate.
Molecular Properties
| Compound Name | [4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate |
| PubChem CID | 88952564 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate |
| SMILES | Cc1cc(-c2cc(C)c(OC(=O)c3cccc(C=O)c3)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C24H22O4/c1-14-8-20(9-15(2)22(14)26)21-10-16(3)23(17(4)11-21)28-24(27)19-7-5-6-18(12-19)13-25/h5-13,26H,1-4H3 |
| InChIKey | GWDJTNNWFOCGTL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate?
The IUPAC name of [4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate (CID 88952564) is [4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate.
What is the SMILES notation for [4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate?
The canonical SMILES for [4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate is Cc1cc(-c2cc(C)c(OC(=O)c3cccc(C=O)c3)c(C)c2)cc(C)c1O.
What is the InChIKey of [4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate?
The InChIKey is GWDJTNNWFOCGTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O4/c1-14-8-20(9-15(2)22(14)26)21-10-16(3)23(17(4)11-21)28-24(27)19-7-5-6-18(12-19)13-25/h5-13,26H,1-4H3.
What are the key properties of [4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate?
[4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate has a molecular weight of 374.44 g/mol, XLogP of 5.32, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenyl] 3-formylbenzoate is sourced from PubChem (CID 88952564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).