C19H20F7N3O5 — CID 88952973
N-[(2R)-2-ethyl-7-fluoro-4-oxo-5-(2,2,2-trifluoroethyl)-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-hydroxy-2-methyl-N'-(2,2,2-trifluoroethyl)propanediamide (PubChem CID 88952973) has the molecular formula C19H20F7N3O5 and a molecular weight of 503.37 g/mol. Its IUPAC name is N-[(2R)-2-ethyl-7-fluoro-4-oxo-5-(2,2,2-trifluoroethyl)-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-hydroxy-2-methyl-N'-(2,2,2-trifluoroethyl)propanediamide.
| Compound Name | N-[(2R)-2-ethyl-7-fluoro-4-oxo-5-(2,2,2-trifluoroethyl)-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-hydroxy-2-methyl-N'-(2,2,2-trifluoroethyl)propanediamide |
|---|---|
| PubChem CID | 88952973 |
| Molecular Formula | C19H20F7N3O5 |
| Molecular Weight | 503.37 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | N-[(2R)-2-ethyl-7-fluoro-4-oxo-5-(2,2,2-trifluoroethyl)-2,3-dihydro-1,5-benzoxazepin-3-yl]-2-hydroxy-2-methyl-N'-(2,2,2-trifluoroethyl)propanediamide |
| SMILES | CC[C@H]1Oc2ccc(F)cc2N(CC(F)(F)F)C(=O)C1NC(=O)C(C)(O)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C19H20F7N3O5/c1-3-11-13(28-16(32)17(2,33)15(31)27-7-18(21,22)23)14(30)29(8-19(24,25)26)10-6-9(20)4-5-12(10)34-11/h4-6,11,13,33H,3,7-8H2,1-2H3,(H,27,31)(H,28,32)/t11-,13?,17?/m1/s1 |
| InChIKey | GECLQDDZCSGTEJ-FFLHNBHYSA-N |
| XLogP | 1.81 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|