C23H34F2O — CID 88953247
1-[(2Z,4Z)-1-(4-ethenylcyclohexyl)-2,3-difluorohepta-2,4-dien-4-yl]-4-(methoxymethylidene)cyclohexane (PubChem CID 88953247) has the molecular formula C23H34F2O and a molecular weight of 364.52 g/mol. Its IUPAC name is 1-[(2Z,4Z)-1-(4-ethenylcyclohexyl)-2,3-difluorohepta-2,4-dien-4-yl]-4-(methoxymethylidene)cyclohexane.
| Compound Name | 1-[(2Z,4Z)-1-(4-ethenylcyclohexyl)-2,3-difluorohepta-2,4-dien-4-yl]-4-(methoxymethylidene)cyclohexane |
|---|---|
| PubChem CID | 88953247 |
| Molecular Formula | C23H34F2O |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 1-[(2Z,4Z)-1-(4-ethenylcyclohexyl)-2,3-difluorohepta-2,4-dien-4-yl]-4-(methoxymethylidene)cyclohexane |
| SMILES | C=CC1CCC(C/C(F)=C(F)\C(=C/CC)C2CCC(=COC)CC2)CC1 |
| InChI | InChI=1S/C23H34F2O/c1-4-6-21(20-13-11-19(12-14-20)16-26-3)23(25)22(24)15-18-9-7-17(5-2)8-10-18/h5-6,16-18,20H,2,4,7-15H2,1,3H3/b19-16-,21-6-,23-22- |
| InChIKey | HWORUELHOMGDCP-SPNFBEMMSA-N |
| XLogP | 7.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|