C27H35F3O — CID 88953273
(3E,11Z,15Z)-4,11,12-trifluoro-2-methoxy-6,9-dimethyl-5,10,13,14,17-pentamethylidenenonadeca-1,3,11,15-tetraene (PubChem CID 88953273) has the molecular formula C27H35F3O and a molecular weight of 432.57 g/mol. Its IUPAC name is (3E,11Z,15Z)-4,11,12-trifluoro-2-methoxy-6,9-dimethyl-5,10,13,14,17-pentamethylidenenonadeca-1,3,11,15-tetraene.
| Compound Name | (3E,11Z,15Z)-4,11,12-trifluoro-2-methoxy-6,9-dimethyl-5,10,13,14,17-pentamethylidenenonadeca-1,3,11,15-tetraene |
|---|---|
| PubChem CID | 88953273 |
| Molecular Formula | C27H35F3O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | (3E,11Z,15Z)-4,11,12-trifluoro-2-methoxy-6,9-dimethyl-5,10,13,14,17-pentamethylidenenonadeca-1,3,11,15-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)C(C)CCC(C)C(=C)/C(F)=C\C(=C)OC)CC |
| InChI | InChI=1S/C27H35F3O/c1-11-17(2)12-13-19(4)23(8)26(29)27(30)24(9)20(5)15-14-18(3)22(7)25(28)16-21(6)31-10/h12-13,16,18,20H,2,4,6-9,11,14-15H2,1,3,5,10H3/b13-12-,25-16+,27-26- |
| InChIKey | ZDLYEJGOWPZWOE-PLLRYYGCSA-N |
| XLogP | 8.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|