C30H34F4O — CID 88953411
3-[4-[(4Z,6Z)-6-(4-ethenylcyclohexa-2,4-dien-1-yl)-4,5-difluoronona-4,6,8-trienyl]cyclohexen-1-yl]-1,2-difluoro-6-methoxycyclohexa-1,3-diene (PubChem CID 88953411) has the molecular formula C30H34F4O and a molecular weight of 486.59 g/mol. Its IUPAC name is 3-[4-[(4Z,6Z)-6-(4-ethenylcyclohexa-2,4-dien-1-yl)-4,5-difluoronona-4,6,8-trienyl]cyclohexen-1-yl]-1,2-difluoro-6-methoxycyclohexa-1,3-diene.
| Compound Name | 3-[4-[(4Z,6Z)-6-(4-ethenylcyclohexa-2,4-dien-1-yl)-4,5-difluoronona-4,6,8-trienyl]cyclohexen-1-yl]-1,2-difluoro-6-methoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 88953411 |
| Molecular Formula | C30H34F4O |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 3-[4-[(4Z,6Z)-6-(4-ethenylcyclohexa-2,4-dien-1-yl)-4,5-difluoronona-4,6,8-trienyl]cyclohexen-1-yl]-1,2-difluoro-6-methoxycyclohexa-1,3-diene |
| SMILES | C=C/C=C(C(\F)=C(\F)CCCC1CC=C(C2=CCC(OC)C(F)=C2F)CC1)/C1C=CC(C=C)=CC1 |
| InChI | InChI=1S/C30H34F4O/c1-4-7-24(22-14-10-20(5-2)11-15-22)28(32)26(31)9-6-8-21-12-16-23(17-13-21)25-18-19-27(35-3)30(34)29(25)33/h4-5,7,10-11,14,16,18,21-22,27H,1-2,6,8-9,12-13,15,17,19H2,3H3/b24-7-,28-26- |
| InChIKey | SIVJLRZFOFODOI-GEBOEUAKSA-N |
| XLogP | 9.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|