C30H25F4NO — CID 88953435
2-[4-[2-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]ethyl]-2,3-difluorophenyl]-5-propylpyridine (PubChem CID 88953435) has the molecular formula C30H25F4NO and a molecular weight of 491.53 g/mol. Its IUPAC name is 2-[4-[2-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]ethyl]-2,3-difluorophenyl]-5-propylpyridine.
| Compound Name | 2-[4-[2-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]ethyl]-2,3-difluorophenyl]-5-propylpyridine |
|---|---|
| PubChem CID | 88953435 |
| Molecular Formula | C30H25F4NO |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 2-[4-[2-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]ethyl]-2,3-difluorophenyl]-5-propylpyridine |
| SMILES | CCCc1ccc(-c2ccc(CCc3ccc(-c4ccc(C5CO5)c(F)c4F)cc3)c(F)c2F)nc1 |
| InChI | InChI=1S/C30H25F4NO/c1-2-3-19-7-15-25(35-16-19)23-12-11-21(27(31)29(23)33)10-6-18-4-8-20(9-5-18)22-13-14-24(26-17-36-26)30(34)28(22)32/h4-5,7-9,11-16,26H,2-3,6,10,17H2,1H3 |
| InChIKey | XHLXPZGJBXHXTL-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|