C23H27BrF6O — CID 88953542
1-[6-bromo-2,2-bis(trifluoromethyl)-1,3-dihydroinden-5-yl]-2-(4-propylcyclohexyl)prop-2-en-1-ol (PubChem CID 88953542) has the molecular formula C23H27BrF6O and a molecular weight of 513.36 g/mol. Its IUPAC name is 1-[6-bromo-2,2-bis(trifluoromethyl)-1,3-dihydroinden-5-yl]-2-(4-propylcyclohexyl)prop-2-en-1-ol.
| Compound Name | 1-[6-bromo-2,2-bis(trifluoromethyl)-1,3-dihydroinden-5-yl]-2-(4-propylcyclohexyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 88953542 |
| Molecular Formula | C23H27BrF6O |
| Molecular Weight | 513.36 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 1-[6-bromo-2,2-bis(trifluoromethyl)-1,3-dihydroinden-5-yl]-2-(4-propylcyclohexyl)prop-2-en-1-ol |
| SMILES | C=C(C1CCC(CCC)CC1)C(O)c1cc2c(cc1Br)CC(C(F)(F)F)(C(F)(F)F)C2 |
| InChI | InChI=1S/C23H27BrF6O/c1-3-4-14-5-7-15(8-6-14)13(2)20(31)18-9-16-11-21(22(25,26)27,23(28,29)30)12-17(16)10-19(18)24/h9-10,14-15,20,31H,2-8,11-12H2,1H3 |
| InChIKey | FEPHVIIOJTZWHE-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.36 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|