C31H47F3O3 — CID 88953656
1-[4-[(1E,3Z,5Z)-5,6-difluoro-4-[4-[[(2E,4E)-5-fluoro-6-propoxyhexa-2,4-dien-3-yl]oxymethyl]cyclohexyl]hepta-1,3,5-trienyl]cyclohexyl]ethanol (PubChem CID 88953656) has the molecular formula C31H47F3O3 and a molecular weight of 524.71 g/mol. Its IUPAC name is 1-[4-[(1E,3Z,5Z)-5,6-difluoro-4-[4-[[(2E,4E)-5-fluoro-6-propoxyhexa-2,4-dien-3-yl]oxymethyl]cyclohexyl]hepta-1,3,5-trienyl]cyclohexyl]ethanol.
| Compound Name | 1-[4-[(1E,3Z,5Z)-5,6-difluoro-4-[4-[[(2E,4E)-5-fluoro-6-propoxyhexa-2,4-dien-3-yl]oxymethyl]cyclohexyl]hepta-1,3,5-trienyl]cyclohexyl]ethanol |
|---|---|
| PubChem CID | 88953656 |
| Molecular Formula | C31H47F3O3 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | 1-[4-[(1E,3Z,5Z)-5,6-difluoro-4-[4-[[(2E,4E)-5-fluoro-6-propoxyhexa-2,4-dien-3-yl]oxymethyl]cyclohexyl]hepta-1,3,5-trienyl]cyclohexyl]ethanol |
| SMILES | C/C=C(\C=C(\F)COCCC)OCC1CCC(C(=C/C=C/C2CCC(C(C)O)CC2)/C(F)=C(\C)F)CC1 |
| InChI | InChI=1S/C31H47F3O3/c1-5-18-36-21-28(33)19-29(6-2)37-20-25-12-16-27(17-13-25)30(31(34)22(3)32)9-7-8-24-10-14-26(15-11-24)23(4)35/h6-9,19,23-27,35H,5,10-18,20-21H2,1-4H3/b8-7+,28-19+,29-6+,30-9-,31-22- |
| InChIKey | GUFDHNAXYMDEIN-HLPBRNPHSA-N |
| XLogP | 8.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|