C28H39F3O3 — CID 88953658
2-[[4-[(2Z,4Z)-2,3-difluoro-4-(4-methoxycyclohexyl)hepta-2,4,6-trienyl]cyclohexyl]methoxy]-3-fluoro-5-methoxycyclohexa-1,3-diene (PubChem CID 88953658) has the molecular formula C28H39F3O3 and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-[[4-[(2Z,4Z)-2,3-difluoro-4-(4-methoxycyclohexyl)hepta-2,4,6-trienyl]cyclohexyl]methoxy]-3-fluoro-5-methoxycyclohexa-1,3-diene.
| Compound Name | 2-[[4-[(2Z,4Z)-2,3-difluoro-4-(4-methoxycyclohexyl)hepta-2,4,6-trienyl]cyclohexyl]methoxy]-3-fluoro-5-methoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 88953658 |
| Molecular Formula | C28H39F3O3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | 2-[[4-[(2Z,4Z)-2,3-difluoro-4-(4-methoxycyclohexyl)hepta-2,4,6-trienyl]cyclohexyl]methoxy]-3-fluoro-5-methoxycyclohexa-1,3-diene |
| SMILES | C=C/C=C(C(\F)=C(\F)CC1CCC(COC2=CCC(OC)C=C2F)CC1)/C1CCC(OC)CC1 |
| InChI | InChI=1S/C28H39F3O3/c1-4-5-24(21-10-12-22(32-2)13-11-21)28(31)26(30)16-19-6-8-20(9-7-19)18-34-27-15-14-23(33-3)17-25(27)29/h4-5,15,17,19-23H,1,6-14,16,18H2,2-3H3/b24-5-,28-26- |
| InChIKey | GPEBZSNWGWJCDH-RWXPECSJSA-N |
| XLogP | 7.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|