C20H38O2S — CID 88953833
2-[(Z)-5-ethyl-2,4,4,5,9,9-hexamethyldec-6-en-2-yl]sulfanylacetic acid (PubChem CID 88953833) has the molecular formula C20H38O2S and a molecular weight of 342.59 g/mol. Its IUPAC name is 2-[(Z)-5-ethyl-2,4,4,5,9,9-hexamethyldec-6-en-2-yl]sulfanylacetic acid.
| Compound Name | 2-[(Z)-5-ethyl-2,4,4,5,9,9-hexamethyldec-6-en-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 88953833 |
| Molecular Formula | C20H38O2S |
| Molecular Weight | 342.59 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 2-[(Z)-5-ethyl-2,4,4,5,9,9-hexamethyldec-6-en-2-yl]sulfanylacetic acid |
| SMILES | CCC(C)(/C=C\CC(C)(C)C)C(C)(C)CC(C)(C)SCC(=O)O |
| InChI | InChI=1S/C20H38O2S/c1-10-20(9,13-11-12-17(2,3)4)18(5,6)15-19(7,8)23-14-16(21)22/h11,13H,10,12,14-15H2,1-9H3,(H,21,22)/b13-11- |
| InChIKey | FDWKZZLJSPUPMQ-QBFSEMIESA-N |
| XLogP | 6.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|