About (4Z,6Z)-3-methylideneocta-4,6-dien-2-imine
(4Z,6Z)-3-methylideneocta-4,6-dien-2-imine (PubChem CID 88953849) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is (4Z,6Z)-3-methylideneocta-4,6-dien-2-imine.
Molecular Properties
| Compound Name | (4Z,6Z)-3-methylideneocta-4,6-dien-2-imine |
| PubChem CID | 88953849 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (4Z,6Z)-3-methylideneocta-4,6-dien-2-imine |
| SMILES | [H]/N=C(\C)C(=C)/C=C\C=C/C |
| InChI | InChI=1S/C9H13N/c1-4-5-6-7-8(2)9(3)10/h4-7,10H,2H2,1,3H3/b5-4-,7-6-,10-9+ |
| InChIKey | QOYIVXURKRITKB-KVEPPTFVSA-N |
| XLogP | 2.71 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,6Z)-3-methylideneocta-4,6-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6Z)-3-methylideneocta-4,6-dien-2-imine?
The IUPAC name of (4Z,6Z)-3-methylideneocta-4,6-dien-2-imine (CID 88953849) is (4Z,6Z)-3-methylideneocta-4,6-dien-2-imine.
What is the SMILES notation for (4Z,6Z)-3-methylideneocta-4,6-dien-2-imine?
The canonical SMILES for (4Z,6Z)-3-methylideneocta-4,6-dien-2-imine is [H]/N=C(\C)C(=C)/C=C\C=C/C.
What is the InChIKey of (4Z,6Z)-3-methylideneocta-4,6-dien-2-imine?
The InChIKey is QOYIVXURKRITKB-KVEPPTFVSA-N. The full InChI is InChI=1S/C9H13N/c1-4-5-6-7-8(2)9(3)10/h4-7,10H,2H2,1,3H3/b5-4-,7-6-,10-9+.
What are the key properties of (4Z,6Z)-3-methylideneocta-4,6-dien-2-imine?
(4Z,6Z)-3-methylideneocta-4,6-dien-2-imine has a molecular weight of 135.21 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6Z)-3-methylideneocta-4,6-dien-2-imine is sourced from PubChem (CID 88953849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).