C5H12N2O — CID 88953890
(Z)-2,3-bis(methylamino)prop-2-en-1-ol (PubChem CID 88953890) has the molecular formula C5H12N2O and a molecular weight of 116.16 g/mol. Its IUPAC name is (Z)-2,3-bis(methylamino)prop-2-en-1-ol.
| Compound Name | (Z)-2,3-bis(methylamino)prop-2-en-1-ol |
|---|---|
| PubChem CID | 88953890 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | (Z)-2,3-bis(methylamino)prop-2-en-1-ol |
| SMILES | CN/C=C(/CO)NC |
| InChI | InChI=1S/C5H12N2O/c1-6-3-5(4-8)7-2/h3,6-8H,4H2,1-2H3/b5-3- |
| InChIKey | OXNGJQOMDPCMSF-HYXAFXHYSA-N |
| XLogP | -0.74 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |