C20H21NO2 — CID 88954197
N-(2-formylphenyl)-6,7-dimethyl-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 88954197) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-(2-formylphenyl)-6,7-dimethyl-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-(2-formylphenyl)-6,7-dimethyl-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 88954197 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-(2-formylphenyl)-6,7-dimethyl-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | Cc1cc2c(cc1C)CC(C(=O)Nc1ccccc1C=O)CC2 |
| InChI | InChI=1S/C20H21NO2/c1-13-9-15-7-8-16(11-18(15)10-14(13)2)20(23)21-19-6-4-3-5-17(19)12-22/h3-6,9-10,12,16H,7-8,11H2,1-2H3,(H,21,23) |
| InChIKey | DFMWFSPUSJESME-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|