C12H16F2O7S — CID 88954546
1,1-difluoro-2-oxo-2-[(2-oxo-5-propan-2-yl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl)oxy]ethanesulfonic acid (PubChem CID 88954546) has the molecular formula C12H16F2O7S and a molecular weight of 342.32 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[(2-oxo-5-propan-2-yl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl)oxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[(2-oxo-5-propan-2-yl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl)oxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 88954546 |
| Molecular Formula | C12H16F2O7S |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[(2-oxo-5-propan-2-yl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl)oxy]ethanesulfonic acid |
| SMILES | CC(C)C1CC2CC(=O)OC2C1OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C12H16F2O7S/c1-5(2)7-3-6-4-8(15)20-9(6)10(7)21-11(16)12(13,14)22(17,18)19/h5-7,9-10H,3-4H2,1-2H3,(H,17,18,19) |
| InChIKey | MTAOPBZSMHDBTJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|