About 6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal
6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal (PubChem CID 88955208) has the molecular formula C12H26O2Si
and a molecular weight of 230.42 g/mol. Its IUPAC name is 6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal.
Molecular Properties
| Compound Name | 6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal |
| PubChem CID | 88955208 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal |
| SMILES | CC(C)(C=O)CCCC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C12H26O2Si/c1-11(2,10-13)8-7-9-12(3,4)15(5,6)14/h10,14H,7-9H2,1-6H3 |
| InChIKey | PEEUNTZSAKFPAC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal?
The IUPAC name of 6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal (CID 88955208) is 6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal.
What is the SMILES notation for 6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal?
The canonical SMILES for 6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal is CC(C)(C=O)CCCC(C)(C)[Si](C)(C)O.
What is the InChIKey of 6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal?
The InChIKey is PEEUNTZSAKFPAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2Si/c1-11(2,10-13)8-7-9-12(3,4)15(5,6)14/h10,14H,7-9H2,1-6H3.
What are the key properties of 6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal?
6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal has a molecular weight of 230.42 g/mol, XLogP of 3.36, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[hydroxy(dimethyl)silyl]-2,2,6-trimethylheptanal is sourced from PubChem (CID 88955208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).