C30H18N4 — CID 88955320
2-[12-(dicyanomethylidene)-2,5,8,11-tetramethylindeno[1,2-b]fluoren-6-ylidene]propanedinitrile (PubChem CID 88955320) has the molecular formula C30H18N4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[12-(dicyanomethylidene)-2,5,8,11-tetramethylindeno[1,2-b]fluoren-6-ylidene]propanedinitrile.
| Compound Name | 2-[12-(dicyanomethylidene)-2,5,8,11-tetramethylindeno[1,2-b]fluoren-6-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 88955320 |
| Molecular Formula | C30H18N4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-[12-(dicyanomethylidene)-2,5,8,11-tetramethylindeno[1,2-b]fluoren-6-ylidene]propanedinitrile |
| SMILES | Cc1ccc2c(c1)C(=C(C#N)C#N)c1c(C)c3c(c(C)c1-2)C(=C(C#N)C#N)c1cc(C)ccc1-3 |
| InChI | InChI=1S/C30H18N4/c1-15-5-7-21-23(9-15)29(19(11-31)12-32)27-18(4)26-22-8-6-16(2)10-24(22)30(20(13-33)14-34)28(26)17(3)25(21)27/h5-10H,1-4H3 |
| InChIKey | JKKUEWFCFPNZDO-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|