C9H17NO — CID 88955502
2,2,7-trimethyl-1-oxido-3,4,5,6-tetrahydroazepin-1-ium (PubChem CID 88955502) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 2,2,7-trimethyl-1-oxido-3,4,5,6-tetrahydroazepin-1-ium.
| Compound Name | 2,2,7-trimethyl-1-oxido-3,4,5,6-tetrahydroazepin-1-ium |
|---|---|
| PubChem CID | 88955502 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 2,2,7-trimethyl-1-oxido-3,4,5,6-tetrahydroazepin-1-ium |
| SMILES | CC1=[N+]([O-])C(C)(C)CCCC1 |
| InChI | InChI=1S/C9H17NO/c1-8-6-4-5-7-9(2,3)10(8)11/h4-7H2,1-3H3 |
| InChIKey | PRFZEMAXTIYZHP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|