About 5H-quinoxalin-5-ide;rhodium
5H-quinoxalin-5-ide;rhodium (PubChem CID 88955708) has the molecular formula C8H5N2Rh-
and a molecular weight of 232.05 g/mol. Its IUPAC name is 5H-quinoxalin-5-ide;rhodium.
Molecular Properties
| Compound Name | 5H-quinoxalin-5-ide;rhodium |
| PubChem CID | 88955708 |
| Molecular Formula | C8H5N2Rh- |
| Molecular Weight | 232.05 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | 5H-quinoxalin-5-ide;rhodium |
| SMILES | [Rh].[c-]1cccc2nccnc12 |
| InChI | InChI=1S/C8H5N2.Rh/c1-2-4-8-7(3-1)9-5-6-10-8;/h1-3,5-6H;/q-1; |
| InChIKey | UUBWAJCVNBFHBV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.05 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5H-quinoxalin-5-ide;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-quinoxalin-5-ide;rhodium?
The IUPAC name of 5H-quinoxalin-5-ide;rhodium (CID 88955708) is 5H-quinoxalin-5-ide;rhodium.
What is the SMILES notation for 5H-quinoxalin-5-ide;rhodium?
The canonical SMILES for 5H-quinoxalin-5-ide;rhodium is [Rh].[c-]1cccc2nccnc12.
What is the InChIKey of 5H-quinoxalin-5-ide;rhodium?
The InChIKey is UUBWAJCVNBFHBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N2.Rh/c1-2-4-8-7(3-1)9-5-6-10-8;/h1-3,5-6H;/q-1;.
What are the key properties of 5H-quinoxalin-5-ide;rhodium?
5H-quinoxalin-5-ide;rhodium has a molecular weight of 232.05 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-quinoxalin-5-ide;rhodium is sourced from PubChem (CID 88955708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).