C32H45N5O2 — CID 88955994
(4aR,6aR,6aR,6bR,9R,12aR,14aR,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-9-(2-methyltetrazol-5-yl)-5,6,6a,7,8,8a,9,10,12,12a,14,14a-dodecahydro-4aH-picene-3,13-dione (PubChem CID 88955994) has the molecular formula C32H45N5O2 and a molecular weight of 531.75 g/mol. Its IUPAC name is (4aR,6aR,6aR,6bR,9R,12aR,14aR,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-9-(2-methyltetrazol-5-yl)-5,6,6a,7,8,8a,9,10,12,12a,14,14a-dodecahydro-4aH-picene-3,13-dione.
| Compound Name | (4aR,6aR,6aR,6bR,9R,12aR,14aR,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-9-(2-methyltetrazol-5-yl)-5,6,6a,7,8,8a,9,10,12,12a,14,14a-dodecahydro-4aH-picene-3,13-dione |
|---|---|
| PubChem CID | 88955994 |
| Molecular Formula | C32H45N5O2 |
| Molecular Weight | 531.75 g/mol |
| Exact Mass | 531.36 |
| IUPAC Name | (4aR,6aR,6aR,6bR,9R,12aR,14aR,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-9-(2-methyltetrazol-5-yl)-5,6,6a,7,8,8a,9,10,12,12a,14,14a-dodecahydro-4aH-picene-3,13-dione |
| SMILES | [C-]#[N+]C1=C[C@]2(C)[C@H]3CC(=O)[C@@H]4[C@@H]5CC(C)(C)C[C@@H](c6nnn(C)n6)C5CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C32H45N5O2/c1-28(2)15-19-18(20(16-28)27-34-36-37(9)35-27)10-12-32(7)25(19)22(38)14-24-30(5)17-21(33-8)26(39)29(3,4)23(30)11-13-31(24,32)6/h17-20,23-25H,10-16H2,1-7,9H3/t18?,19-,20-,23+,24-,25+,30+,31-,32-/m1/s1 |
| InChIKey | AVHODJHJKFBFFX-VKIQJANESA-N |
| XLogP | 6.19 |
| TPSA | 82.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.75 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|