C8H14O2 — CID 88956071
(1R,2R,5S)-2-butan-2-yl-3,6-dioxabicyclo[3.1.0]hexane (PubChem CID 88956071) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (1R,2R,5S)-2-butan-2-yl-3,6-dioxabicyclo[3.1.0]hexane.
| Compound Name | (1R,2R,5S)-2-butan-2-yl-3,6-dioxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 88956071 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (1R,2R,5S)-2-butan-2-yl-3,6-dioxabicyclo[3.1.0]hexane |
| SMILES | CCC(C)[C@H]1OC[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C8H14O2/c1-3-5(2)7-8-6(10-8)4-9-7/h5-8H,3-4H2,1-2H3/t5?,6-,7+,8-/m0/s1 |
| InChIKey | HWEHIPOQMNOHIO-VMEVTNHQSA-N |
| XLogP | 1.20 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|