About 2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde
2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde (PubChem CID 88956857) has the molecular formula C22H23O3P
and a molecular weight of 366.40 g/mol. Its IUPAC name is 2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde.
Molecular Properties
| Compound Name | 2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde |
| PubChem CID | 88956857 |
| Molecular Formula | C22H23O3P |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde |
| SMILES | COCOc1c(CC2C=CC=CC2)cccc1Pc1ccccc1C=O |
| InChI | InChI=1S/C22H23O3P/c1-24-16-25-22-18(14-17-8-3-2-4-9-17)11-7-13-21(22)26-20-12-6-5-10-19(20)15-23/h2-8,10-13,15,17,26H,9,14,16H2,1H3 |
| InChIKey | MMTKCYBOGBMMLV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde?
The IUPAC name of 2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde (CID 88956857) is 2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde.
What is the SMILES notation for 2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde?
The canonical SMILES for 2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde is COCOc1c(CC2C=CC=CC2)cccc1Pc1ccccc1C=O.
What is the InChIKey of 2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde?
The InChIKey is MMTKCYBOGBMMLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23O3P/c1-24-16-25-22-18(14-17-8-3-2-4-9-17)11-7-13-21(22)26-20-12-6-5-10-19(20)15-23/h2-8,10-13,15,17,26H,9,14,16H2,1H3.
What are the key properties of 2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde?
2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde has a molecular weight of 366.40 g/mol, XLogP of 3.79, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(cyclohexa-2,4-dien-1-ylmethyl)-2-(methoxymethoxy)phenyl]phosphanylbenzaldehyde is sourced from PubChem (CID 88956857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).