C17H17F3N2O — CID 88957052
2-[(3E,5Z)-5-ethylocta-1,3,5-trien-4-yl]-6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 88957052) has the molecular formula C17H17F3N2O and a molecular weight of 322.33 g/mol. Its IUPAC name is 2-[(3E,5Z)-5-ethylocta-1,3,5-trien-4-yl]-6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 2-[(3E,5Z)-5-ethylocta-1,3,5-trien-4-yl]-6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 88957052 |
| Molecular Formula | C17H17F3N2O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-[(3E,5Z)-5-ethylocta-1,3,5-trien-4-yl]-6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | C=C/C=C(C(=C/CC)\CC)/c1nc2cc(C(F)(F)F)cnc2o1 |
| InChI | InChI=1S/C17H17F3N2O/c1-4-7-11(6-3)13(8-5-2)15-22-14-9-12(17(18,19)20)10-21-16(14)23-15/h5,7-10H,2,4,6H2,1,3H3/b11-7-,13-8+ |
| InChIKey | KQVLWPOBYCXQRL-JKNYEHFOSA-N |
| XLogP | 5.56 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|