About (3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine
(3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine (PubChem CID 88957062) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is (3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine.
Molecular Properties
| Compound Name | (3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine |
| PubChem CID | 88957062 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C\C(=C)OCCN(C)C |
| InChI | InChI=1S/C10H18N2O/c1-9(11)5-6-10(2)13-8-7-12(3)4/h5-6H,1-2,7-8,11H2,3-4H3/b6-5- |
| InChIKey | NGGYPACUQYDGHB-WAYWQWQTSA-N |
| XLogP | 1.11 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine?
The IUPAC name of (3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine (CID 88957062) is (3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine.
What is the SMILES notation for (3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine?
The canonical SMILES for (3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine is C=C(N)/C=C\C(=C)OCCN(C)C.
What is the InChIKey of (3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine?
The InChIKey is NGGYPACUQYDGHB-WAYWQWQTSA-N. The full InChI is InChI=1S/C10H18N2O/c1-9(11)5-6-10(2)13-8-7-12(3)4/h5-6H,1-2,7-8,11H2,3-4H3/b6-5-.
What are the key properties of (3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine?
(3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine has a molecular weight of 182.27 g/mol, XLogP of 1.11, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-[2-(dimethylamino)ethoxy]hexa-1,3,5-trien-2-amine is sourced from PubChem (CID 88957062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).