C13H21N — CID 88957085
(2E,4Z)-2,5-dimethyl-6-methylidenedeca-2,4,9-trien-1-amine (PubChem CID 88957085) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (2E,4Z)-2,5-dimethyl-6-methylidenedeca-2,4,9-trien-1-amine.
| Compound Name | (2E,4Z)-2,5-dimethyl-6-methylidenedeca-2,4,9-trien-1-amine |
|---|---|
| PubChem CID | 88957085 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (2E,4Z)-2,5-dimethyl-6-methylidenedeca-2,4,9-trien-1-amine |
| SMILES | C=CCCC(=C)/C(C)=C\C=C(/C)CN |
| InChI | InChI=1S/C13H21N/c1-5-6-7-12(3)13(4)9-8-11(2)10-14/h5,8-9H,1,3,6-7,10,14H2,2,4H3/b11-8+,13-9- |
| InChIKey | VAGODOPQSSBKPG-YGOOLXEZSA-N |
| XLogP | 3.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|