C15H26O — CID 88957224
(3E,5Z)-3-butoxy-4,8-dimethylnona-1,3,5-triene (PubChem CID 88957224) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (3E,5Z)-3-butoxy-4,8-dimethylnona-1,3,5-triene.
| Compound Name | (3E,5Z)-3-butoxy-4,8-dimethylnona-1,3,5-triene |
|---|---|
| PubChem CID | 88957224 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (3E,5Z)-3-butoxy-4,8-dimethylnona-1,3,5-triene |
| SMILES | C=C/C(OCCCC)=C(C)\C=C/CC(C)C |
| InChI | InChI=1S/C15H26O/c1-6-8-12-16-15(7-2)14(5)11-9-10-13(3)4/h7,9,11,13H,2,6,8,10,12H2,1,3-5H3/b11-9-,15-14+ |
| InChIKey | MGHUISXEPLRMSL-DVRQTUGZSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|