C10H18N2 — CID 88957256
(3Z,8Z)-5-methyl-1,2,5,6,7,10-hexahydroazecin-2-amine (PubChem CID 88957256) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (3Z,8Z)-5-methyl-1,2,5,6,7,10-hexahydroazecin-2-amine.
| Compound Name | (3Z,8Z)-5-methyl-1,2,5,6,7,10-hexahydroazecin-2-amine |
|---|---|
| PubChem CID | 88957256 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (3Z,8Z)-5-methyl-1,2,5,6,7,10-hexahydroazecin-2-amine |
| SMILES | CC1/C=C\C(N)NC/C=C\CC1 |
| InChI | InChI=1S/C10H18N2/c1-9-5-3-2-4-8-12-10(11)7-6-9/h2,4,6-7,9-10,12H,3,5,8,11H2,1H3/b4-2-,7-6- |
| InChIKey | URPXVOGQLASYRU-YEKSRDOCSA-N |
| XLogP | 1.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|