About hex-5-ene-1,5-diamine
hex-5-ene-1,5-diamine (PubChem CID 88957286) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is hex-5-ene-1,5-diamine.
Molecular Properties
| Compound Name | hex-5-ene-1,5-diamine |
| PubChem CID | 88957286 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | hex-5-ene-1,5-diamine |
| SMILES | C=C(N)CCCCN |
| InChI | InChI=1S/C6H14N2/c1-6(8)4-2-3-5-7/h1-5,7-8H2 |
| InChIKey | QCKOSUPKBZZCTP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hex-5-ene-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-5-ene-1,5-diamine?
The IUPAC name of hex-5-ene-1,5-diamine (CID 88957286) is hex-5-ene-1,5-diamine.
What is the SMILES notation for hex-5-ene-1,5-diamine?
The canonical SMILES for hex-5-ene-1,5-diamine is C=C(N)CCCCN.
What is the InChIKey of hex-5-ene-1,5-diamine?
The InChIKey is QCKOSUPKBZZCTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2/c1-6(8)4-2-3-5-7/h1-5,7-8H2.
What are the key properties of hex-5-ene-1,5-diamine?
hex-5-ene-1,5-diamine has a molecular weight of 114.19 g/mol, XLogP of 0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hex-5-ene-1,5-diamine is sourced from PubChem (CID 88957286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).