C17H14Cl2F3NO — CID 88957446
(E)-N-(4-chlorophenoxy)-1-[5-chloro-2-(trifluoromethyl)phenyl]butan-1-imine (PubChem CID 88957446) has the molecular formula C17H14Cl2F3NO and a molecular weight of 376.21 g/mol. Its IUPAC name is (E)-N-(4-chlorophenoxy)-1-[5-chloro-2-(trifluoromethyl)phenyl]butan-1-imine.
| Compound Name | (E)-N-(4-chlorophenoxy)-1-[5-chloro-2-(trifluoromethyl)phenyl]butan-1-imine |
|---|---|
| PubChem CID | 88957446 |
| Molecular Formula | C17H14Cl2F3NO |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | (E)-N-(4-chlorophenoxy)-1-[5-chloro-2-(trifluoromethyl)phenyl]butan-1-imine |
| SMILES | CCC/C(=N\Oc1ccc(Cl)cc1)c1cc(Cl)ccc1C(F)(F)F |
| InChI | InChI=1S/C17H14Cl2F3NO/c1-2-3-16(23-24-13-7-4-11(18)5-8-13)14-10-12(19)6-9-15(14)17(20,21)22/h4-10H,2-3H2,1H3/b23-16+ |
| InChIKey | JVJWOEVPOJQQFV-XQNSMLJCSA-N |
| XLogP | 6.60 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|