C24H23NO5 — CID 88957558
(13aS)-2,3,6,12-tetramethoxy-13a,14-dihydro-9H-phenanthro[9,10-f]indolizin-11-one (PubChem CID 88957558) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is (13aS)-2,3,6,12-tetramethoxy-13a,14-dihydro-9H-phenanthro[9,10-f]indolizin-11-one.
| Compound Name | (13aS)-2,3,6,12-tetramethoxy-13a,14-dihydro-9H-phenanthro[9,10-f]indolizin-11-one |
|---|---|
| PubChem CID | 88957558 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (13aS)-2,3,6,12-tetramethoxy-13a,14-dihydro-9H-phenanthro[9,10-f]indolizin-11-one |
| SMILES | COC1=C[C@@H]2Cc3c(c4ccc(OC)cc4c4cc(OC)c(OC)cc34)CN2C1=O |
| InChI | InChI=1S/C24H23NO5/c1-27-14-5-6-15-17(9-14)19-11-22(29-3)21(28-2)10-18(19)16-7-13-8-23(30-4)24(26)25(13)12-20(15)16/h5-6,8-11,13H,7,12H2,1-4H3/t13-/m0/s1 |
| InChIKey | IZXFFZYQXDFSEE-ZDUSSCGKSA-N |
| XLogP | 3.82 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|