C18H29N — CID 88957650
4-butan-2-yl-N-[(4Z)-5-methylhepta-4,6-dien-2-yl]cyclohexa-1,3-dien-1-amine (PubChem CID 88957650) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 4-butan-2-yl-N-[(4Z)-5-methylhepta-4,6-dien-2-yl]cyclohexa-1,3-dien-1-amine.
| Compound Name | 4-butan-2-yl-N-[(4Z)-5-methylhepta-4,6-dien-2-yl]cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 88957650 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 4-butan-2-yl-N-[(4Z)-5-methylhepta-4,6-dien-2-yl]cyclohexa-1,3-dien-1-amine |
| SMILES | C=C/C(C)=C\CC(C)NC1=CC=C(C(C)CC)CC1 |
| InChI | InChI=1S/C18H29N/c1-6-14(3)8-9-16(5)19-18-12-10-17(11-13-18)15(4)7-2/h6,8,10,12,15-16,19H,1,7,9,11,13H2,2-5H3/b14-8- |
| InChIKey | BHPDYOCXOFWBEO-ZSOIEALJSA-N |
| XLogP | 5.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|