About 4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine
4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine (PubChem CID 88957780) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine.
Molecular Properties
| Compound Name | 4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine |
| PubChem CID | 88957780 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine |
| SMILES | CC/C=C(C)\C=C\CN1CCOCC1 |
| InChI | InChI=1S/C12H21NO/c1-3-5-12(2)6-4-7-13-8-10-14-11-9-13/h4-6H,3,7-11H2,1-2H3/b6-4+,12-5- |
| InChIKey | IGSDGECXKAILCV-QEVYESBGSA-N |
| XLogP | 2.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine?
The IUPAC name of 4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine (CID 88957780) is 4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine.
What is the SMILES notation for 4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine?
The canonical SMILES for 4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine is CC/C=C(C)\C=C\CN1CCOCC1.
What is the InChIKey of 4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine?
The InChIKey is IGSDGECXKAILCV-QEVYESBGSA-N. The full InChI is InChI=1S/C12H21NO/c1-3-5-12(2)6-4-7-13-8-10-14-11-9-13/h4-6H,3,7-11H2,1-2H3/b6-4+,12-5-.
What are the key properties of 4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine?
4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine has a molecular weight of 195.31 g/mol, XLogP of 2.23, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2E,4Z)-4-methylhepta-2,4-dienyl]morpholine is sourced from PubChem (CID 88957780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).