C23H22N2O4S — CID 88958050
4-[[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]cyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 88958050) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is 4-[[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]cyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 4-[[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]cyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 88958050 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 4-[[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]cyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | C/C(=N\NC(=O)C1C=CC(C(=O)O)=CC1)c1csc(-c2ccc3c(c2)CCC3)c1O |
| InChI | InChI=1S/C23H22N2O4S/c1-13(24-25-22(27)15-6-8-16(9-7-15)23(28)29)19-12-30-21(20(19)26)18-10-5-14-3-2-4-17(14)11-18/h5-6,8-12,15,26H,2-4,7H2,1H3,(H,25,27)(H,28,29)/b24-13+ |
| InChIKey | CBLDATAIGRNGSN-ZMOGYAJESA-N |
| XLogP | 4.04 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|