C13H27N — CID 88958075
(5S)-3,5-diethyl-5-methyloct-7-en-2-amine (PubChem CID 88958075) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is (5S)-3,5-diethyl-5-methyloct-7-en-2-amine.
| Compound Name | (5S)-3,5-diethyl-5-methyloct-7-en-2-amine |
|---|---|
| PubChem CID | 88958075 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | (5S)-3,5-diethyl-5-methyloct-7-en-2-amine |
| SMILES | C=CC[C@](C)(CC)CC(CC)C(C)N |
| InChI | InChI=1S/C13H27N/c1-6-9-13(5,8-3)10-12(7-2)11(4)14/h6,11-12H,1,7-10,14H2,2-5H3/t11?,12?,13-/m0/s1 |
| InChIKey | RWLNPLCNFLCOKS-BPCQOVAHSA-N |
| XLogP | 3.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|