C26H29NO7 — CID 88958094
N-[7-[(2R,4S,5R)-4-hydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-2-phenylacetamide (PubChem CID 88958094) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is N-[7-[(2R,4S,5R)-4-hydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-2-phenylacetamide.
| Compound Name | N-[7-[(2R,4S,5R)-4-hydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 88958094 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-[7-[(2R,4S,5R)-4-hydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-2-phenylacetamide |
| SMILES | CO[C@@H]1[C@@H](O)C[C@H](Oc2ccc3cc(NC(=O)Cc4ccccc4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C26H29NO7/c1-15-20(32-22-14-19(28)24(31-4)26(2,3)34-22)11-10-17-13-18(25(30)33-23(15)17)27-21(29)12-16-8-6-5-7-9-16/h5-11,13,19,22,24,28H,12,14H2,1-4H3,(H,27,29)/t19-,22+,24+/m0/s1 |
| InChIKey | YWUMPIFKRVRHNU-BPUDTRNYSA-N |
| XLogP | 3.56 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|