About 3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline
3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline (PubChem CID 88958372) has the molecular formula C22H31N
and a molecular weight of 309.50 g/mol. Its IUPAC name is 3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline.
Molecular Properties
| Compound Name | 3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline |
| PubChem CID | 88958372 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline |
| SMILES | Nc1cccc(CCCCCCCCC2C=CC3=C(CC3)C2)c1 |
| InChI | InChI=1S/C22H31N/c23-22-11-7-10-18(17-22)8-5-3-1-2-4-6-9-19-12-13-20-14-15-21(20)16-19/h7,10-13,17,19H,1-6,8-9,14-16,23H2 |
| InChIKey | QXHHWDBMAPBYGP-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline?
The IUPAC name of 3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline (CID 88958372) is 3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline.
What is the SMILES notation for 3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline?
The canonical SMILES for 3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline is Nc1cccc(CCCCCCCCC2C=CC3=C(CC3)C2)c1.
What is the InChIKey of 3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline?
The InChIKey is QXHHWDBMAPBYGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N/c23-22-11-7-10-18(17-22)8-5-3-1-2-4-6-9-19-12-13-20-14-15-21(20)16-19/h7,10-13,17,19H,1-6,8-9,14-16,23H2.
What are the key properties of 3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline?
3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline has a molecular weight of 309.50 g/mol, XLogP of 6.21, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[8-(3-bicyclo[4.2.0]octa-1(6),4-dienyl)octyl]aniline is sourced from PubChem (CID 88958372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).