C18H26Cl2N2O2 — CID 88958386
2-(chloroamino)-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methylbutan-1-one (PubChem CID 88958386) has the molecular formula C18H26Cl2N2O2 and a molecular weight of 373.32 g/mol. Its IUPAC name is 2-(chloroamino)-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methylbutan-1-one.
| Compound Name | 2-(chloroamino)-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 88958386 |
| Molecular Formula | C18H26Cl2N2O2 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-(chloroamino)-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)C(NCl)C(=O)N1CC[C@](O)(c2ccc(Cl)cc2)C(C)(C)C1 |
| InChI | InChI=1S/C18H26Cl2N2O2/c1-12(2)15(21-20)16(23)22-10-9-18(24,17(3,4)11-22)13-5-7-14(19)8-6-13/h5-8,12,15,21,24H,9-11H2,1-4H3/t15?,18-/m0/s1 |
| InChIKey | PUXPRCFZKPLVJK-PKHIMPSTSA-N |
| XLogP | 3.55 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|