About 2-sulfanyloxyacetamide
2-sulfanyloxyacetamide (PubChem CID 88958482) has the molecular formula C2H5NO2S
and a molecular weight of 107.13 g/mol. Its IUPAC name is 2-sulfanyloxyacetamide.
Molecular Properties
| Compound Name | 2-sulfanyloxyacetamide |
| PubChem CID | 88958482 |
| Molecular Formula | C2H5NO2S |
| Molecular Weight | 107.13 g/mol |
| Exact Mass | 107.00 |
| IUPAC Name | 2-sulfanyloxyacetamide |
| SMILES | NC(=O)COS |
| InChI | InChI=1S/C2H5NO2S/c3-2(4)1-5-6/h6H,1H2,(H2,3,4) |
| InChIKey | CJLWKSRIJVJFGQ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.13 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanyloxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanyloxyacetamide?
The IUPAC name of 2-sulfanyloxyacetamide (CID 88958482) is 2-sulfanyloxyacetamide.
What is the SMILES notation for 2-sulfanyloxyacetamide?
The canonical SMILES for 2-sulfanyloxyacetamide is NC(=O)COS.
What is the InChIKey of 2-sulfanyloxyacetamide?
The InChIKey is CJLWKSRIJVJFGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2S/c3-2(4)1-5-6/h6H,1H2,(H2,3,4).
What are the key properties of 2-sulfanyloxyacetamide?
2-sulfanyloxyacetamide has a molecular weight of 107.13 g/mol, XLogP of -0.67, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanyloxyacetamide is sourced from PubChem (CID 88958482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).